| CAS ID | 71-00-1 |
|---|---|
| IUPAC Name | L-Histidine |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | |
| SMILES | N[C@@H](CC1=CNC=N1)C(O)=O |
| CAS ID | 71-00-1 |
|---|---|
| IUPAC Name | L-Histidine |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | |
| SMILES | N[C@@H](CC1=CNC=N1)C(O)=O |
| 6274 |
Synonym: l-histidine, histidine, h-his-oh, glyoxaline-5-alanine, anti-rheuma, l—histidine, istidina, s-histidine, l-histidin
| Ammonium | 0.02% max. |
| Arsenic (As) | 1ppm max. |
| Assay Percent Range | 98.5 to 101.0 % |
| Heavy Metals (as Pb) | 10ppm max. |
| Ignition Residue | 0.10% max. |
| Identification | Pass Test |
| Merck Index | 15, 4758 |
| Loss on Drying | 0.20% max. |
| Packaging | Glass Bottle |
| Related Substances | Not Detected Detected/Not Detect. |
| Formula Weight | 155.16 |
| Specific Rotation | 12.0 to 13.0° (+ or -) |
| Physical Form | Solid |
| State of Solution (%T) | 98.0% min. |
| Alpha Vector | Histidine |
| Color | White |
| Melting Point | 282°C |
| pH | 7.0 to 8.5 |
| Chemical Name or Material | L-Histidine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
