| CAS ID | 303-26-4 |
|---|---|
| IUPAC Name | 1-[(4-chlorophenyl)-phenylmethyl]piperazine |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1CN(CCN1)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
| CAS ID | 303-26-4 |
|---|---|
| IUPAC Name | 1-[(4-chlorophenyl)-phenylmethyl]piperazine |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1CN(CCN1)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
| 9340 |
Synonym: 1-4-chlorobenzhydryl piperazine, norchlorcyclizine, 1-4-chlorophenyl phenyl methyl piperazine, n-p-chlorobenzhydryl piperazine, 4-4-chlorobenzhydryl piperazine, 1-4-chlorophenyl phenylmethyl piperazine, n-4-chlorobenzhydryl piperazine, 1-4-chlorophenyl-phenylmethyl piperazine
| Melting Point | 75°C |
| Color | White |
| Boiling Point | 180°C |
| Formula Weight | 286.80 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1-(4-Chlorobenzhydryl)piperazine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
