| CAS ID | 586-78-7 |
|---|---|
| IUPAC Name | 1-Bromo-4-nitrobenzene |
| Molecular Formula | C6H4BrNO2 |
| Molecular Weight | |
| SMILES | [O-][N+](=O)C1=CC=C(Br)C=C1 |
| CAS ID | 586-78-7 |
|---|---|
| IUPAC Name | 1-Bromo-4-nitrobenzene |
| Molecular Formula | C6H4BrNO2 |
| Molecular Weight | |
| SMILES | [O-][N+](=O)C1=CC=C(Br)C=C1 |
| 11466 |
Synonym: 4-bromonitrobenzene, 4-nitrobromobenzene, p-bromonitrobenzene, benzene, 1-bromo-4-nitro, p-nitrobromobenzene, 4-nitrophenyl bromide, 4-bromo-1-nitrobenzene, p-nitrophenyl bromide, 1-bromo-4-nitro-benzene, ccris 3115
| Boiling Point | 256°C |
| Melting Point | 127°C |
| Color | Undesignated |
| UN Number | 3459 |
| Formula Weight | 202.01 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1-Bromo-4-nitrobenzene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
