| CAS ID | 131-91-9 |
|---|---|
| IUPAC Name | 1-nitrosonaphthalen-2-ol |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2N=O)O |
| CAS ID | 131-91-9 |
|---|---|
| IUPAC Name | 1-nitrosonaphthalen-2-ol |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2N=O)O |
| 8580 |
Synonym:1-nitroso-2-naphthol, 2-naphthalenol, 1-nitroso, nitroso-beta-naphthol, 2-naphthol, 1-nitroso, 1-nitroso-2-naftol, zelen moridlova 4, zelen moridlova 4 czech, alpha-nitroso-beta-naphthol, 1-nitroso-2-naftol czech, unii-757i55u2qx
| Color | Undesignated |
| Melting Point | 107°C |
| Formula Weight | 173.17 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1-Nitroso-2-naphthol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
Nitrosonaphthol is widely used in the chemical industry to synthesize colours and as an organic chemistry reagent. Because of its reactive qualities, it is versatile and may be used in various production processes.
The Nitroso Naphthol structure is a naphthalene ring with a nitroso group (-NO) connected to one of its locations, making it a helpful molecule in chemical synthesis and dye manufacturing.
Yes, the Nitroso Naphthol structure substantially impacts its reactivity, particularly in reactions involving electron transfer and metal complexation. This is critical for its usage in dyes and analytical chemistry.
This compound's Nitroso Naphthol structure allows it to react with various substrates, resulting in brilliant colours utilized in textiles, inks, and other dye industry applications.
Yes, Nitroso Naphthol is used in various analytical procedures, notably for detecting metal ions and other chemicals due to its high reactivity in several chemical tests.
