| CAS ID | 3443-45-6 |
|---|---|
| IUPAC Name | 4-(pyren-1-yl)butanoic acid |
| Molecular Formula | C20H16O2 |
| Molecular Weight | |
| SMILES | OC(=O)CCCC1=CC=C2C=CC3=CC=CC4=CC=C1C2=C34 |
| CAS ID | 3443-45-6 |
|---|---|
| IUPAC Name | 4-(pyren-1-yl)butanoic acid |
| Molecular Formula | C20H16O2 |
| Molecular Weight | |
| SMILES | OC(=O)CCCC1=CC=C2C=CC3=CC=CC4=CC=C1C2=C34 |
| 76977 |
Synonym: 1-pyrenebutyric acid, 4-pyren-1-yl butanoic acid, 1-pyrenebutanoic acid, 1-pyrenylbutyric acid, pyrene-3-butyric acid, pyrenebutanoic acid, pyrene-1-butyric acid, pyrenebutyric acid, 4-1-pyrenyl butyric acid, gamma-3-pyrenyl butyric acid
| Color | Yellow |
| Melting Point | 189°C |
| Formula Weight | 288.35 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1-Pyrenebutyric Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
