| CAS ID | 3923-52-2 |
|---|---|
| IUPAC Name | 1, 1-Diphenyl-2-propyn-1-ol |
| Molecular Formula | C15H12O |
| Molecular Weight | |
| SMILES | C#CC(C1=CC=CC=C1)(C2=CC=CC=C2)O |
| CAS ID | 3923-52-2 |
|---|---|
| IUPAC Name | 1, 1-Diphenyl-2-propyn-1-ol |
| Molecular Formula | C15H12O |
| Molecular Weight | |
| SMILES | C#CC(C1=CC=CC=C1)(C2=CC=CC=C2)O |
| 92976 |
Synonym: 1,1-diphenyl-2-propyn-1-ol, diphenylethinylcarbinol, ethynyldiphenylmethanol, 1,1-diphenylpropargyl alcohol, diphenylethynylcarbinol, 3,3-diphenyl-3-hydroxy-1-propyne, benzenemethanol, .alpha.-ethynyl-.alpha.-phenyl, 2-propyn-1-ol, 1,1-diphenyl, benzenemethanol, alpha-ethynyl-alpha-phenyl, benzenemethanol, a-ethynyl-a-phenyl
| Color | White-Yellow |
| Boiling Point | 200°C |
| Melting Point | 48°C |
| Formula Weight | 208.26 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1,1-Diphenyl-2-propyn-1-ol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
