| CAS ID | 3194-55-6 |
|---|---|
| IUPAC Name | 1,2,5,6,9,10-hexabromocyclododecane |
| Molecular Formula | C12H18Br6 |
| Molecular Weight | |
| SMILES | C1CC(C(CCC(C(CCC(C1Br)Br)Br)Br)Br)Br |
| CAS ID | 3194-55-6 |
|---|---|
| IUPAC Name | 1,2,5,6,9,10-hexabromocyclododecane |
| Molecular Formula | C12H18Br6 |
| Molecular Weight | |
| SMILES | C1CC(C(CCC(C(CCC(C1Br)Br)Br)Br)Br)Br |
| 18529 |
Synonym: cyclododecane, 1,2,5,6,9,10-hexabromo, hbcd, dsstox_cid_7527, dsstox_rid_78489, dsstox_gsid_27527, saytex hbcd-lm, acmc-1bn89, ksc491m2h, 1,2,5,6,9,10-hexabromocyclododecane, 1,2,5,6,9,10-hexabromocyclododecane 25g
| Melting Point | 177°C |
| Color | Undesignated |
| Formula Weight | 641.70 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1,2,5,6,9,10-Hexabromocyclododecane |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
