| CAS ID | 7511-49-1 |
|---|---|
| IUPAC Name | 1,3,5-tris(4-bromophenyl)benzene |
| Molecular Formula | C24H15Br3 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br)Br |
| CAS ID | 7511-49-1 |
|---|---|
| IUPAC Name | 1,3,5-tris(4-bromophenyl)benzene |
| Molecular Formula | C24H15Br3 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br)Br |
| 232761 |
Synonym:1,3,5-tris 4-bromophenyl benzene, 4,4-dibromo-5′-4-bromophenyl-1,1′:3′,1-terphenyl, 1,1′:3′,1-terphenyl, 4,4-dibromo-5′-4-bromophenyl, 4′-bromo-3,5-bis 4-bromophenyl-1,1′-biphenyl, acmc-209ox3, ksc496e7d, 1,3,5-tris p-bromophenyl benzene, 1,3,5-tri 4-bromophenyl benzene, 4,4-dibromo-5′-4-bromophenyl-1,1′
| Color | Undesignated |
| Melting Point | 263°C |
| Formula Weight | 543.10 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1,3,5-Tris(4-bromophenyl)benzene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
