| CAS ID | 1009-61-6 |
|---|---|
| IUPAC Name | 1-(4-acetylphenyl)ethan-1-one |
| Molecular Formula | C10H10O2 |
| Molecular Weight | |
| SMILES | CC(=O)C1=CC=C(C=C1)C(C)=O |
| CAS ID | 1009-61-6 |
|---|---|
| IUPAC Name | 1-(4-acetylphenyl)ethan-1-one |
| Molecular Formula | C10H10O2 |
| Molecular Weight | |
| SMILES | CC(=O)C1=CC=C(C=C1)C(C)=O |
| 13888 |
Synonym:1,4-diacetylbenzene, 1,1′-1,4-phenylene diethanone, p-diacetylbenzene, p-acetylacetophenone, benzene, p-diacetyl, ethanone, 1,1′-1,4-phenylene bis, 1-4-acetylphenyl ethanone, 1-4-acetylphenyl ethan-1-one, 1,1-1,4-phenylene bis-ethanone, 4-acetylacetophenone
| Color | White |
| Melting Point | 113°C |
| Boiling Point | 120°C |
| Formula Weight | 162.19 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1,4-Diacetylbenzene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
