| CAS ID | 2012-74-0 |
|---|---|
| IUPAC Name | 2-(4-Chlorophenyl)-3-methylbutyric acid |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | |
| SMILES | CC(C)C(C(O)=O)C1=CC=C(Cl)C=C1 |
| CAS ID | 2012-74-0 |
|---|---|
| IUPAC Name | 2-(4-Chlorophenyl)-3-methylbutyric acid |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | |
| SMILES | CC(C)C(C(O)=O)C1=CC=C(Cl)C=C1 |
| 16197 |
| Color | White-Yellow |
| Melting Point | 89°C |
| Formula Weight | 212.67 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-(4-Chlorophenyl)-3-methylbutyric Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
