![Structure of 2-Chloro-[4-(trifluoromethyl)-benzene]-boronic acid | 254993-59-4](https://www.sarchemlabs.com/wp-content/uploads/2021/11/S2902.png)
| CAS ID | 254993-59-4 |
|---|---|
| IUPAC Name | [2-chloro-4-(trifluoromethyl)phenyl]boronic acid |
| Molecular Formula | C7H5BClF3O2 |
| Molecular Weight | |
| SMILES | OB(O)C1=C(Cl)C=C(C=C1)C(F)(F)F |
| CAS ID | 254993-59-4 |
|---|---|
| IUPAC Name | [2-chloro-4-(trifluoromethyl)phenyl]boronic acid |
| Molecular Formula | C7H5BClF3O2 |
| Molecular Weight | |
| SMILES | OB(O)C1=C(Cl)C=C(C=C1)C(F)(F)F |
| 2783251 |
Synonym : 2-chloro-4-trifluoromethyl phenylboronic acid, 2-chloro-4-trifluoromethylphenylboronic acid, 2-chloro-4-trifluoromethyl benzeneboronic acid, 2-chloro-4-trifluoromethyl phenyl boronic acid, 2-chloro-4-trifluoromethyl phenylboronicacid, 2-chloro-4-trifluoromethylphenyl boronic acid, boronic acid, 2-chloro-4-trifluoromethyl phenyl, 2-fluoro-4-iodophenylboronicacid
| Melting Point | 110°C to 112°C |
| Beilstein | 9263388 |
| Formula Weight | 224.38 |
| Chemical Name or Material | 2-Chloro-4-(trifluoromethyl)benzeneboronic acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
