| CAS ID | 434-75-3 |
|---|---|
| IUPAC Name | 2-Chloro-6-fluorobenzoic Acid |
| Molecular Formula | C7H4ClFO2 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)O)F |
| CAS ID | 434-75-3 |
|---|---|
| IUPAC Name | 2-Chloro-6-fluorobenzoic Acid |
| Molecular Formula | C7H4ClFO2 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)O)F |
| 67947 |
Synonym: benzoic acid, 2-chloro-6-fluoro, unii-euq5bp41s0, euq5bp41s0, 2-fluoro-6-chlorobenzoic acid, gnf-pf-2650, 2-chloro-6-fluoro-benzoic acid, 2-chloro-6-fluorobenzoicacid, pubchem1372, acmc-1ctwn, ksc238i3p
| Melting Point | 158°C |
| Color | Undesignated |
| Formula Weight | 174.56 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-Chloro-6-fluorobenzoic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
