| CAS ID | 84-51-5 |
|---|---|
| IUPAC Name | 2-ethylanthracene-9,10-dione |
| Molecular Formula | C16H12O2 |
| Molecular Weight | |
| SMILES | CCC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O |
| CAS ID | 84-51-5 |
|---|---|
| IUPAC Name | 2-ethylanthracene-9,10-dione |
| Molecular Formula | C16H12O2 |
| Molecular Weight | |
| SMILES | CCC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O |
| 6772 |
Synonym: 2-ethylanthraquinone, 2-ethyl anthraquinone, 2-ethyl-9,10-anthraquinone, anthraquinone, 2-ethyl, 9,10-anthracenedione, 2-ethyl, usaf so-1, beta-ethylanthraquinone, unii-59yj81qzkd, 59yj81qzkd, 2-ethylanthra-9,10-quinone
| Melting Point | 108°C |
| Boiling Point | 190°C |
| Color | Undesignated |
| Formula Weight | 236.27 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-Ethylanthraquinone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
