| CAS ID | 76697-50-2 |
|---|---|
| IUPAC Name | 2-(propane-2-sulfonyl)aniline |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | |
| SMILES | CC(C)S(=O)(=O)C1=CC=CC=C1N |
| CAS ID | 76697-50-2 |
|---|---|
| IUPAC Name | 2-(propane-2-sulfonyl)aniline |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | |
| SMILES | CC(C)S(=O)(=O)C1=CC=CC=C1N |
| 12646366 |
Synonym: 2-Aminophenyl Isopropyl Sulfone
| Color | Undesignated |
| Melting Point | 85°C |
| Formula Weight | 199.27 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-(Isopropylsulfonyl)aniline |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
