| CAS ID | 93-09-4 |
|---|---|
| IUPAC Name | naphthalene-2-carboxylic acid |
| Molecular Formula | C11H8O2 |
| Molecular Weight | |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)O |
| CAS ID | 93-09-4 |
|---|---|
| IUPAC Name | naphthalene-2-carboxylic acid |
| Molecular Formula | C11H8O2 |
| Molecular Weight | |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)O |
| 7123 |
Synonym: 2-naphthoic acid, 2-naphthalenecarboxylic acid, isonaphthoic acid, 2-carboxynaphthalene, 2-maythic acid, beta-naphthoic acid, ne-2-carboxylic acid, unii-qlg01v0w2l, naphthalene-beta-carboxylic acid, .beta.-naphthoic acid
| Melting Point | 185°C |
| Color | White-Yellow |
| Formula Weight | 172.18 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-Naphthoic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
