| CAS ID | 613-62-7 |
|---|---|
| IUPAC Name | 2-phenylmethoxynaphthalene |
| Molecular Formula | C17H14O |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)COC2=CC3=CC=CC=C3C=C2 |
| CAS ID | 613-62-7 |
|---|---|
| IUPAC Name | 2-phenylmethoxynaphthalene |
| Molecular Formula | C17H14O |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)COC2=CC3=CC=CC=C3C=C2 |
| 123080 |
Synonym: benzyl 2-naphthyl ether, 2-benzyloxy naphthalene, 2-benzyloxynaphthalene, naphthalene, 2-phenylmethoxy, 2-phenylmethoxy naphthalene, 2-phenylmethoxy-naphthalene, 2-benzyloxy-naphthalene, 2-phenylmethoxy naphthalenen, benzyl2-naphthylether, b-naphthylbenzyl ether
| Color | White |
| Melting Point | 102°C |
| Formula Weight | 234.30 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Benzyl 2-Naphthyl Ether |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
