| CAS ID | 79-97-0 |
|---|---|
| IUPAC Name | 4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol |
| Molecular Formula | C17H20O2 |
| Molecular Weight | |
| SMILES | CC(C1=CC=C(O)C(C)=C1)(C2=CC=C(O)C(C)=C2)C |
| CAS ID | 79-97-0 |
|---|---|
| IUPAC Name | 4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol |
| Molecular Formula | C17H20O2 |
| Molecular Weight | |
| SMILES | CC(C1=CC=C(O)C(C)=C1)(C2=CC=C(O)C(C)=C2)C |
PubChem CID 6620
Alternate Names:4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol
| Melting Point | 139°C |
| Color | White |
| Formula Weight | 256.35 |
| Physical Form | Crystal-Powder at 20°C |
| Percent Purity | ≥98.0% (GC) |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
