| CAS ID | 2379-60-4 |
|---|---|
| IUPAC Name | 2,3-dichloro-6-nitroquinoxaline |
| Molecular Formula | C8H3Cl2N3O2 |
| Molecular Weight | |
| SMILES | [O-][N+](=O)C1=CC=C2N=C(Cl)C(Cl)=NC2=C1 |
| CAS ID | 2379-60-4 |
|---|---|
| IUPAC Name | 2,3-dichloro-6-nitroquinoxaline |
| Molecular Formula | C8H3Cl2N3O2 |
| Molecular Weight | |
| SMILES | [O-][N+](=O)C1=CC=C2N=C(Cl)C(Cl)=NC2=C1 |
| 689090 |
| Melting Point | 153°C |
| Color | White-Yellow |
| Formula Weight | 244.03 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,3-Dichloro-6-nitroquinoxaline |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
