| CAS ID | 131-56-6 |
|---|---|
| IUPAC Name | (2,4-dihydroxyphenyl)-phenylmethanone |
| Molecular Formula | C13H10O3 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)O)O |
| CAS ID | 131-56-6 |
|---|---|
| IUPAC Name | (2,4-dihydroxyphenyl)-phenylmethanone |
| Molecular Formula | C13H10O3 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)O)O |
| 8572 |
Synonym:2,4-dihydroxybenzophenone, 2,4-dihydroxyphenyl phenyl methanone, benzophenone-1, benzoresorcinol, resbenzophenone, inhibitor dhbp, uvinul 400, advastab 48, uvistat 12, methanone, 2,4-dihydroxyphenyl phenyl
| Melting Point | 144°C |
| Color | Yellow |
| Formula Weight | 214.22 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,4-Dihydroxybenzophenone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
