| CAS ID | 146548-59-6 |
|---|---|
| IUPAC Name | 2,4,6-trimethoxyphenyl)methanamine;hydrochloride |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | |
| SMILES | COC1=CC(=C(C(=C1)OC)CN)OC.Cl |
| CAS ID | 146548-59-6 |
|---|---|
| IUPAC Name | 2,4,6-trimethoxyphenyl)methanamine;hydrochloride |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | |
| SMILES | COC1=CC(=C(C(=C1)OC)CN)OC.Cl |
| 16211914 |
Synonym: 2,4,6-trimethoxybenzylamine hydrochloride, 2,4,6-trimethoxyphenyl methanamine hydrochloride, 1-2,4,6-trimethoxyphenyl methanamine hydrochloride, pubchem7389, 2, 4, 6-trimethoxybenzylamine hydrochloride, acmc-1c5nr, benzenemethanamine, 2,4,6-trimethoxy-, hydrochloride, 1-2,4,6-trimethoxyphenyl methanamine-hydrogen chloride 1/1
| Melting Point | 204°C to 207°C |
| Color | White |
| Packaging | Glass bottle |
| Infrared Spectrum | Authentic |
| CAS Min % | 97.5 |
| CAS Max % | 100.0 |
| Assay Percent Range | 97.5% min. (HPLC) |
| Formula Weight | 233.7 |
| Physical Form | Powder |
| Chemical Name or Material | 2, 4, 6-Trimethoxybenzylamine hydrochloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
