![Chemical structure of 2,5-Bis(trimethylstannyl)-thieno [3,2-b]thiophene | 469912-82-1](https://www.sarchemlabs.com/wp-content/uploads/2021/12/S3245.png)
| CAS ID | 469912-82-1 |
|---|---|
| IUPAC Name | trimethyl[5-(trimethylstannyl)thieno[3,2-b]thiophen-2-yl]stannane |
| Molecular Formula | C12H20S2Sn2 |
| Molecular Weight | |
| SMILES | C[Sn](C)(C)C1=CC2=C(S1)C=C(S2)[Sn](C)(C)C |
| CAS ID | 469912-82-1 |
|---|---|
| IUPAC Name | trimethyl[5-(trimethylstannyl)thieno[3,2-b]thiophen-2-yl]stannane |
| Molecular Formula | C12H20S2Sn2 |
| Molecular Weight | |
| SMILES | C[Sn](C)(C)C1=CC2=C(S1)C=C(S2)[Sn](C)(C)C |
| 12978043 |
| Color | Undesignated |
| Melting Point | 129°C |
| UN Number | 3146 |
| Formula Weight | 465.83 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,5-Bis(trimethylstannyl)thieno[3,2-b]thiophene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
