![Chemical structure of [2,6-Dichloro-4-(trifluoromethyl)phenyl]hydrazine | 86398-94-9](https://www.sarchemlabs.com/wp-content/uploads/2021/07/S1400.png)
| CAS ID | 86398-94-9 |
|---|---|
| IUPAC Name | [2, 6-Dichloro-4-(trifluoromethyl)phenyl]hydrazine |
| Molecular Formula | C7H5Cl2F3N2 |
| Molecular Weight | |
| SMILES | NNC1=C(Cl)C=C(C(F)(F)F)C=C1Cl |
| CAS ID | 86398-94-9 |
|---|---|
| IUPAC Name | [2, 6-Dichloro-4-(trifluoromethyl)phenyl]hydrazine |
| Molecular Formula | C7H5Cl2F3N2 |
| Molecular Weight | |
| SMILES | NNC1=C(Cl)C=C(C(F)(F)F)C=C1Cl |
| 688223 |
Synonym:2,6-dichloro-4-trifluoromethyl phenylhydrazine, 2,6-dichloro-4-trifluoromethyl phenyl hydrazine, 2,6-dichloro-4-trifluoro methylphenylhydrozine, 1-2,6-dichloro-4-trifluoromethyl phenyl hydrazine, pubchem4487, 3,5-dichloro-4-hydrazinobenzotrifluoride, 2,6-dichloro4-trifluoromethylphenylhydrazine, 2,6-dichloro-4-trifluoromethylphenylhydrazine, 2,6-dichloro-4-trifluoro methylphenylhydrazine
| Melting Point | 57°C to 61°C |
| Beilstein | 8319619 |
| Formula Weight | 245.03 |
| Chemical Name or Material | 2,6-Dichloro-4-(trifluoromethyl)phenylhydrazine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
