| CAS ID | 581-42-0 |
|---|---|
| IUPAC Name | 2,6-dimethylnaphthalene |
| Molecular Formula | C12H12 |
| Molecular Weight | |
| SMILES | CC1=CC2=C(C=C1)C=C(C=C2)C |
| CAS ID | 581-42-0 |
|---|---|
| IUPAC Name | 2,6-dimethylnaphthalene |
| Molecular Formula | C12H12 |
| Molecular Weight | |
| SMILES | CC1=CC2=C(C=C1)C=C(C=C2)C |
| 11387 |
Synonym: naphthalene, 2,6-dimethyl, dimethylnaphthalene, mixture of isomers, 2,6-dmn, 2,6-dimethyl-naphthalene, unii-76u29qw3fm, 2,6-dimethylphthalene, 2,6-dimethylnaphthalen, naphthalene, 2,6-or 2,7-dimethyl, 2.6-dimethylnaphthalene, acmc-1arta
| Color | White |
| Melting Point | 111°C |
| Formula Weight | 156.23 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,6-Dimethylnaphthalene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
