| CAS ID | 1207-15-4 |
|---|---|
| IUPAC Name | 4,12-dimethyl-8-thiatricyclo[7.4.0.0²,⁷]trideca-1(9),2(7),3,5,10,12-hexaene |
| Molecular Formula | C14H12S |
| Molecular Weight | |
| SMILES | CC1=CC2=C(SC3=C2C=C(C)C=C3)C=C1 |
| CAS ID | 1207-15-4 |
|---|---|
| IUPAC Name | 4,12-dimethyl-8-thiatricyclo[7.4.0.0²,⁷]trideca-1(9),2(7),3,5,10,12-hexaene |
| Molecular Formula | C14H12S |
| Molecular Weight | |
| SMILES | CC1=CC2=C(SC3=C2C=C(C)C=C3)C=C1 |
| 50959 |
| Color | White-Yellow |
| Melting Point | 120°C |
| Formula Weight | 212.31 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,8-Dimethyldibenzothiophene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
