| CAS ID | 161957-55-7 |
|---|---|
| IUPAC Name | 3-Chloro-2-fluorobenzoic Acid |
| Molecular Formula | C7H4ClFO2 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)Cl)F)C(=O)O |
| CAS ID | 161957-55-7 |
|---|---|
| IUPAC Name | 3-Chloro-2-fluorobenzoic Acid |
| Molecular Formula | C7H4ClFO2 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)Cl)F)C(=O)O |
| 302931 |
Synonym: 2-fluoro-3-chlorobenzoic acid, 3-chloro-2-fluoro benzoic acid, 3-chloro-2-fluoro-benzoic acid, 3-chloro-2-fluorobenzoicacid, 3-chloro-2-fluorbenzoic acid, pubchem1332, acmc-209dnj, intermediates-zcf02219, benzoic acid, chlorofluoro, ksc112c3l
| Melting Point | 177°C |
| Color | Undesignated |
| Formula Weight | 174.56 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 3-Chloro-2-fluorobenzoic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
