| CAS ID | 7423-93-0 |
|---|---|
| IUPAC Name | (2S)-2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)N)Cl)O |
| CAS ID | 7423-93-0 |
|---|---|
| IUPAC Name | (2S)-2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)N)Cl)O |
| 110992 |
Synonym: 3-chlorotyrosine, 3-chloro-l-tyrosine, 3-cl-tyr-oh, unii-sy44c9mina, sy44c9mina, s-2-amino-3-3-chloro-4-hydroxyphenyl propanoic acid, 2s-2-amino-3-3-chloro-4-hydroxyphenyl propanoic acid, pubchem11980, 3-chloro-4-hydroxy-l-phenylalanine
| Beilstein | 2941263 |
| Formula Weight | 215.64 |
| Melting Point | ∽250°C (decomposition) |
| Chemical Name or Material | 3-Chloro-L-tyrosine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
