| CAS ID | 701-27-9 |
|---|---|
| IUPAC Name | 3-fluorobenzene-1-sulfonyl chloride |
| Molecular Formula | C6H4ClFO2S |
| Molecular Weight | |
| SMILES | FC1=CC(=CC=C1)S(Cl)(=O)=O |
| CAS ID | 701-27-9 |
|---|---|
| IUPAC Name | 3-fluorobenzene-1-sulfonyl chloride |
| Molecular Formula | C6H4ClFO2S |
| Molecular Weight | |
| SMILES | FC1=CC(=CC=C1)S(Cl)(=O)=O |
| 2734258 |
Synonym: 3-fluorobenzene-1-sulfonyl chloride, m-fluorobenzenesulfonyl chloride, 3-fluorobenzenesulfonylchloride, 3-fluorobenzenesulphonyl chloride, 3-fluoro-benzenesulfonyl chloride, 3-fluorophenylsulfonyl chloride, benzenesulfonyl chloride, 3-fluoro, pubchem5156, acmc-209od0, 3-fluorobenzensulfonylchloride
| Melting Point | 7°C |
| Boiling Point | 113°C |
| Color | Yellow |
| UN Number | 3265 |
| Formula Weight | 194.60 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | 3-Fluorobenzenesulfonyl Chloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
C6H4ClFO2S is the 3-Fluorobenzenesulfonyl chloride chemical formula. Mostly employed in organic synthesis, especially for pharmaceutical and agrochemical uses, this chemical is part of the sulfonyl chloride family.
Depending on purity and experimental setup, the 3-Fluorobenzenesulfonyl chloride melting point usually falls within a certain temperature range. Quality control in chemical synthesis and uses of chemistry depends on accurate melting point data.
Crucially, a physical characteristic that affects handling and application in chemical processes is the 3-Fluorobenzenesulfonyl chloride boiling point. Accurate boiling point values guarantee suitable use under regulated circumstances and storage.
The 3-Fluorobenzenesulfonyl chloride finds usage in material science, agrochemical synthesis, and pharmaceutical development as an intermediary. It is extensively used in the synthesis of various speciality chemicals and sulfonamide variants.
C6H4ClFO2S is the 3-Fluorobenzenesulfonyl chloride molecular formula. This chemical molecule shows the precise mix of carbon, hydrogen, fluorine, chlorine, oxygen, and sulfur.
