| CAS ID | 89-25-8 |
|---|---|
| IUPAC Name | 5-methyl-2-phenyl-4H-pyrazol-3-one |
| Molecular Formula | C10H10N2O |
| Molecular Weight | |
| SMILES | CC1=NN(C(=O)C1)C2=CC=CC=C2 |
| CAS ID | 89-25-8 |
|---|---|
| IUPAC Name | 5-methyl-2-phenyl-4H-pyrazol-3-one |
| Molecular Formula | C10H10N2O |
| Molecular Weight | |
| SMILES | CC1=NN(C(=O)C1)C2=CC=CC=C2 |
| 4021 |
Synonym: edaravone, 3-methyl-1-phenyl-2-pyrazolin-5-one, norphenazone, radicut, 1-phenyl-3-methyl-5-pyrazolone, developer z, methylphenylpyrazolone, norantipyrine, c.i. developer 1, phenylmethylpyrazolone
| Boiling Point | 287°C |
| Melting Point | 129°C |
| Color | White-Yellow |
| Formula Weight | 174.20 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 3-Methyl-1-phenyl-5-pyrazolone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
