| CAS ID | 1134-47-0 |
|---|---|
| IUPAC Name | 4-amino-3-(4-chlorophenyl)butanoic acid |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)CN)Cl |
| CAS ID | 1134-47-0 |
|---|---|
| IUPAC Name | 4-amino-3-(4-chlorophenyl)butanoic acid |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)CN)Cl |
| 2284 |
Synonym : baclofen, lioresal, baclon, 4-amino-3-4-chlorophenyl butanoic acid, dl-baclofen, kemstro, gabalon, baclofene, baclofeno, baclofenum
| Color | Undesignated |
| Melting Point | 208°C |
| UN Number | 2811 |
| Formula Weight | 213.66 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Baclofen |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
