| CAS ID | 41295-20-9 |
|---|---|
| IUPAC Name | 4-(4-methylphenoxy)aniline |
| Molecular Formula | C13H13NO |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)N |
| CAS ID | 41295-20-9 |
|---|---|
| IUPAC Name | 4-(4-methylphenoxy)aniline |
| Molecular Formula | C13H13NO |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)N |
| 94519 |
Synonym: 4-Aminophenyl p-Tolyl Ether, 4-(p-Tolyloxy)aniline
| Color | Undesignated |
| Melting Point | 122°C |
| Quantity | 25g |
| Formula Weight | 199.25 |
| Physical Form | Crystal-Powder at 20°C |
| Percent Purity | ≥98.0% (T) |
| Chemical Name or Material | 4-Amino-4′-methyldiphenyl Ether |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
