| CAS ID | 20780-72-7 |
|---|---|
| IUPAC Name | 4-bromo-1H-indole-2,3-dione |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)C(=O)N2 |
| CAS ID | 20780-72-7 |
|---|---|
| IUPAC Name | 4-bromo-1H-indole-2,3-dione |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)C(=O)N2 |
| 4500012 |
Synonym : 4-Bromoindole-2,3-dione, 4-Bromo-2,3-indolinedione
| Color | Undesignated |
| Melting Point | 271°C |
| Formula Weight | 226.03 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4-Bromoisatin |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
