| CAS ID | 823-85-8 |
|---|---|
| IUPAC Name | hydrogen (4-fluorophenyl)hydrazine chloride |
| Molecular Formula | C6H8ClFN2 |
| Molecular Weight | |
| SMILES | [H+].[Cl-].NNC1=CC=C(F)C=C1 |
| CAS ID | 823-85-8 |
|---|---|
| IUPAC Name | hydrogen (4-fluorophenyl)hydrazine chloride |
| Molecular Formula | C6H8ClFN2 |
| Molecular Weight | |
| SMILES | [H+].[Cl-].NNC1=CC=C(F)C=C1 |
| 69981 |
Synonym: 4-fluorophenylhydrazine hydrochloride, 4-fluorophenyl hydrazine hydrochloride, 4-fluorophenylhydrazine hcl, 1-4-fluorophenyl hydrazine hydrochloride, 4-fluorophenyl hydrazine hcl, p-fluorophenylhydrazine hydrochloride, 4-fluorphenyl hydrazine hydrochloride, 4-fluorophenyl hydrazine monohydrochloride, p-fluorophenylhydrazine hcl, hydrazine, 4-fluorophenyl-, monohydrochloride
| Color | Undesignated |
| Formula Weight | 162.59 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4-Fluorophenylhydrazine Hydrochloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
