| CAS ID | 59026-32-3 |
|---|---|
| IUPAC Name | 5-ethyl-5-(4-methylphenyl)-1,3-diazinane-4,6-dione |
| Molecular Formula | C5H6N2O |
| Molecular Weight | |
| SMILES | CCC1(C(=O)NCNC1=O)C2=CC=C(C=C2)C |
| CAS ID | 59026-32-3 |
|---|---|
| IUPAC Name | 5-ethyl-5-(4-methylphenyl)-1,3-diazinane-4,6-dione |
| Molecular Formula | C5H6N2O |
| Molecular Weight | |
| SMILES | CCC1(C(=O)NCNC1=O)C2=CC=C(C=C2)C |
| 100785 |
Synonym : 4-methylprimidone, 5-ethyl-5-4-methylphenyl-1,3-diazinane-4,6-dione, 5-ethyldihydro-5-p-tolyl-1h,5h-pyrimidine-4,6-dione, 5-ethyl-5-4-methylphenyl-hexahydropyrimidine-4,6-dione, 5-ethyldihydro-5-4-methylphenyl-4,6 1h,5h-pyrimidinedione, 5-ethyl-5-4-methylphenyl-1,2,3,5-tetrahydropyrimidine-4,6-dione
| CAS Min % | 99.0 |
| CAS Max % | 100.0 |
| Color | White |
| Melting Point | 293°C to 295°C |
| Infrared Spectrum | Authentic |
| Formula Weight | 232.28 |
| Physical Form | Crystalline Powder |
| Chemical Name or Material | 4-Methylprimidone, 99+% |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
