| CAS ID | 99-81-0 |
|---|---|
| IUPAC Name | 2-bromo-1-(4-nitrophenyl)ethanone |
| Molecular Formula | C8H6BrNO3 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C(=O)CBr)[N+](=O)[O-] |
| CAS ID | 99-81-0 |
|---|---|
| IUPAC Name | 2-bromo-1-(4-nitrophenyl)ethanone |
| Molecular Formula | C8H6BrNO3 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C(=O)CBr)[N+](=O)[O-] |
| 66840 |
Synonym:2-bromo-4′-nitroacetophenone, 2-bromo-1-4-nitrophenyl ethanone, 4-nitrophenacyl bromide, p-nitrophenacyl bromide, 2-bromo-1-4-nitrophenyl ethan-1-one, alpha-bromo-p-nitroacetophenone, ethanone, 2-bromo-1-4-nitrophenyl, 4′-nitrophenacyl bromide, alpha-bromo-4-nitroacetophenone, 2-bromo-4-nitroacetophenone
| Melting Point | 98°C |
| Color | Undesignated |
| UN Number | 1759 |
| Formula Weight | 244.04 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-Bromo-4′-nitroacetophenone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
