| CAS ID | 5466-84-2 |
|---|---|
| IUPAC Name | 5-nitro-2-benzofuran-1,3-dione |
| Molecular Formula | C8H3NO5 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)OC2=O |
| CAS ID | 5466-84-2 |
|---|---|
| IUPAC Name | 5-nitro-2-benzofuran-1,3-dione |
| Molecular Formula | C8H3NO5 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)OC2=O |
| 230976 |
Synonym:4-nitrophthalic anhydride, 5-nitroisobenzofuran-1,3-dione, phthalic anhydride, 4-nitro, 1,3-isobenzofurandione, 5-nitro, 4-nitrophthalic acid anhydride, 5-nitrophthalic anhydride, unii-sqn32ua63n, ccris 4684, 5-nitro-1,3-isobenzofurandione, sqn32ua63n
| Boiling Point | 197°C |
| Color | Yellow |
| Melting Point | 120°C |
| Formula Weight | 193.11 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4-Nitrophthalic Anhydride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
