![Chemical structure of 4'-(trifluoromethyl)-[1,1'-biphenyl]-2-carboxylic acid](https://www.sarchemlabs.com/wp-content/uploads/2021/06/S1965.webp)
| CAS ID | 84392-17-6 |
|---|---|
| IUPAC Name | 4'-(trifluoromethyl)-[1,1'-biphenyl]-2-carboxylic acid |
| Molecular Formula | C14H9F3O2 |
| Molecular Weight | |
| SMILES | OC(=O)C1=CC=CC=C1C1=CC=C(C=C1)C(F)(F)F |
| CAS ID | 84392-17-6 |
|---|---|
| IUPAC Name | 4'-(trifluoromethyl)-[1,1'-biphenyl]-2-carboxylic acid |
| Molecular Formula | C14H9F3O2 |
| Molecular Weight | |
| SMILES | OC(=O)C1=CC=CC=C1C1=CC=C(C=C1)C(F)(F)F |
| 55251 |
Synonym: xenalipin, 4-trifluoromethyl-2′-biphenylcarboxylic acid, xenalipine, 4′-trifluoromethyl-1,1′-biphenyl-2-carboxylic acid, 2-4-trifluoromethyl phenyl benzoic acid, 4′-trifluoromethyl biphenyl-2-carboxylic acid, 4′-trifluoromethyl-2-biphenylcarboxylic acid, 2-4-trifluoromethylphenyl benzoic acid, 4′-trifluoromethyl 1,1′-biphenyl-2-carboxylic acid, 1,1′-biphenyl-2-carboxylic acid, 4′-trifluoromethyl
| Color | White |
| Melting Point | 171°C |
| Formula Weight | 266.22 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4′-(Trifluoromethyl)biphenyl-2-carboxylic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
