| CAS ID | 1131-18-6 |
|---|---|
| IUPAC Name | 5-methyl-2-phenylpyrazol-3-amine |
| Molecular Formula | C10H11N3 |
| Molecular Weight | |
| SMILES | CC1=NN(C2=CC=CC=C2)C(N)=C1 |
| CAS ID | 1131-18-6 |
|---|---|
| IUPAC Name | 5-methyl-2-phenylpyrazol-3-amine |
| Molecular Formula | C10H11N3 |
| Molecular Weight | |
| SMILES | CC1=NN(C2=CC=CC=C2)C(N)=C1 |
| PubChem CID | 70801 |
Synonyms
3-Methyl-1-phenyl-1H-pyrazol-5-amine, 1131-18-6, 1H-Pyrazol-5-amine, 3-methyl-1-phenyl-, 1-Phenyl-3-methyl-5-aminopyrazole, 5-Methyl-2-phenyl-2H-pyrazol-3-ylamine, 5-methyl-2-phenylpyrazol-3-amine
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
