| CAS ID | 87-48-9 |
|---|---|
| IUPAC Name | 5-bromo-1H-indole-2,3-dione |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C(=O)N2 |
| CAS ID | 87-48-9 |
|---|---|
| IUPAC Name | 5-bromo-1H-indole-2,3-dione |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C(=O)N2 |
| 6889 |
Synonym : 5-bromoisatin, 5-bromoindoline-2,3-dione, 5-bromoindole-2,3-dione, isatin, 5-bromo, 5-bromisatin, 1h-indole-2,3-dione, 5-bromo, 5-bromisatin czech, 5-bromo-2,3-dihydro-1h-indole-2,3-dione, indole-2,3-dione, 5-bromo, 5-bromoisatin monohydrate
| Color | Undesignated |
| Melting Point | 253°C |
| Formula Weight | 226.03 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 5-Bromoisatin |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
