| CAS ID | 98-19-1 |
|---|---|
| IUPAC Name | 1-tert-butyl-3,5-dimethylbenzene |
| Molecular Formula | C12H18 |
| Molecular Weight | |
| SMILES | CC1=CC(=CC(=C1)C(C)(C)C)C |
| CAS ID | 98-19-1 |
|---|---|
| IUPAC Name | 1-tert-butyl-3,5-dimethylbenzene |
| Molecular Formula | C12H18 |
| Molecular Weight | |
| SMILES | CC1=CC(=CC(=C1)C(C)(C)C)C |
| 7378 |
Synonym: 5-tert-butyl-m-xylene, 1-tert-butyl-3,5-dimethylbenzene, m-xylene, 5-tert-butyl, 1,3-dimethyl-5-tert-butylbenzene, benzene, 1-1,1-dimethylethyl-3,5-dimethyl, 5-tert-butyl-1,3-dimethylbenzene, benzene, 5-tert-butyl-1,3-dimethyl, 1,3-dimethyl-5-t-butylbenzene, 5-t-butyl-1,3-dimethylbenzene, benzene, 1,3-dimethyl-5-1,1-dimethylethyl
| Color | Colorless |
| Boiling Point | 202°C |
| Formula Weight | 162.28 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | 5-tert-Butyl-m-xylene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
