| CAS ID | 69-78-3 |
|---|---|
| IUPAC Name | 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid |
| Molecular Formula | C14H8N2O8S2 |
| Molecular Weight | |
| SMILES | OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
| CAS ID | 69-78-3 |
|---|---|
| IUPAC Name | 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid |
| Molecular Formula | C14H8N2O8S2 |
| Molecular Weight | |
| SMILES | OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
| 6254 |
Synonym: dtnb, 5,5′-dithiobis 2-nitrobenzoic acid, ellman’s reagent, 3-carboxy-4-nitrophenyl disulfide, dithionitrobenzoic acid, dithiobisnitrobenzoic acid, 5,5′-disulfanediylbis 2-nitrobenzoic acid, benzoic acid, 3,3′-dithiobis 6-nitro, 3,3′-dithiobis 6-nitrobenzoic acid, 5,5′-dithio-bis 2-nitrobenzoic acid
| Color | Yellow |
| Formula Weight | 396.34 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 5,5′-Dithiobis(2-nitrobenzoic Acid) [for Determination of SH groups] |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
