| CAS ID | 6326-79-0 |
|---|---|
| IUPAC Name | 6-bromo-2,3-dihydro-1H-indole-2,3-dione |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | |
| SMILES | BrC1=CC=C2C(NC(=O)C2=O)=C1 |
| CAS ID | 6326-79-0 |
|---|---|
| IUPAC Name | 6-bromo-2,3-dihydro-1H-indole-2,3-dione |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | |
| SMILES | BrC1=CC=C2C(NC(=O)C2=O)=C1 |
| 95716 |
Synonyms: 6-bromoisatin, 6-bromoindoline-2,3-dione, 6-bromo-isatin, 1h-indole-2,3-dione, 6-bromo, 6-bromoindole-2,3-dione, 6-bromo-2,3-dihydro-1h-indole-2,3-dione, 6-bromo-1h-benzo d azolidine-2,3-dione, 6-bromoindolin-2,3-dione, 6-bromo-2,3-indolinedione
| Melting Point | 274°C |
| Color | Undesignated |
| Formula Weight | 226.03 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 6-Bromoisatin |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
