| CAS ID | 61-19-8 |
|---|---|
| IUPAC Name | Adenosine Monophosphate |
| Molecular Formula | C10H14N5O7P |
| Molecular Weight | |
| SMILES | O[C@@H]([C@H]([C@H](N1C=NC2=C(N=CN=C21)N)O3)O)[C@H]3COP(O)(O)=O |
| CAS ID | 61-19-8 |
|---|---|
| IUPAC Name | Adenosine Monophosphate |
| Molecular Formula | C10H14N5O7P |
| Molecular Weight | |
| SMILES | O[C@@H]([C@H]([C@H](N1C=NC2=C(N=CN=C21)N)O3)O)[C@H]3COP(O)(O)=O |
| 6083 |
Synonym: adenosine 5′-monophosphate, 5′-adenylic acid, adenosine monophosphate, adenosine phosphate, adenylic acid, adenylate, phosphaden, 5′-amp, adenosine 5′-phosphate, phosphentaside
| Color | White |
| Melting Point | 200°C |
| Formula Weight | 347.22 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 5′-Adenylic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
