| CAS ID | 16941-11-0 |
|---|---|
| IUPAC Name | azanium;hexafluorophosphate |
| Molecular Formula | F6H4NP |
| Molecular Weight | |
| SMILES | [NH4+].F[P-](F)(F)(F)(F)F |
| CAS ID | 16941-11-0 |
|---|---|
| IUPAC Name | azanium;hexafluorophosphate |
| Molecular Formula | F6H4NP |
| Molecular Weight | |
| SMILES | [NH4+].F[P-](F)(F)(F)(F)F |
| 9793912 |
Synonym : ammonium hexafluorophosphate, ammonium hexafluorophosphate v, ammonium hexafluophosphate, ammoniumhexafluorophosphate 6ci,7ci, unii-ns308031pj, azanium hexafluorophosphate, nh4pf6, ksc492g2j, ammonium hexafluoro-, e5-phosphanuide, ammonium phosphorus hexafluoride
| Assay Percent Range | 99% |
| Linear Formula | NH4PF6 |
| Merck Index | 15, 523 |
| Solubility Information | Solubility in water: 74.8g/100mL (20 c). Other solubilities: soluble in acetone,methanol,ethanol and methyl,acetate |
| Formula Weight | 163 |
| Physical Form | Crystalline Powder or Needles |
| Grade | Pure |
| Density | 2.1800g/mL |
| Elemental Analysis | 98.5 % min. |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
