| CAS ID | 119-52-8 |
|---|---|
| IUPAC Name | 2-hydroxy-1,2-bis(4-methoxyphenyl)ethan-1-one |
| Molecular Formula | C14H12O2 |
| Molecular Weight | |
| SMILES | COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 |
| CAS ID | 119-52-8 |
|---|---|
| IUPAC Name | 2-hydroxy-1,2-bis(4-methoxyphenyl)ethan-1-one |
| Molecular Formula | C14H12O2 |
| Molecular Weight | |
| SMILES | COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 |
| 95415 |
Synonym: anisoin, 2-hydroxy-1,2-bis 4-methoxyphenyl ethanone, 4,4′-dimethoxybenzoin, p-anisoin, ethanone, 2-hydroxy-1,2-bis 4-methoxyphenyl, benzoin, 4,4′-dimethoxy, p,p’-dimethoxybenzoin, benzoin,4′-dimethoxy, 4,4′-anisoin, 1,2-bis 4-methoxyphenyl-2-hydroxyethan-1-one
| Melting Point | 112°C |
| Color | White-Yellow |
| Formula Weight | 272.30 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Anisoin |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
