S2372 All Products Tags Ketones, Organic compounds, Phenylpropanoids and polyketides

Anisoin | 119-52-8

Additional information

CAS ID	119-52-8
IUPAC Name	2-hydroxy-1,2-bis(4-methoxyphenyl)ethan-1-one
Molecular Formula	C14H12O2
Molecular Weight	212.248
SMILES	COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1

General Information

Additional information

CAS ID	119-52-8
IUPAC Name	2-hydroxy-1,2-bis(4-methoxyphenyl)ethan-1-one
Molecular Formula	C14H12O2
Molecular Weight	212.248
SMILES	COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1

Description

PubChem CID

95415

Synonym: anisoin, 2-hydroxy-1,2-bis 4-methoxyphenyl ethanone, 4,4′-dimethoxybenzoin, p-anisoin, ethanone, 2-hydroxy-1,2-bis 4-methoxyphenyl, benzoin, 4,4′-dimethoxy, p,p’-dimethoxybenzoin, benzoin,4′-dimethoxy, 4,4′-anisoin, 1,2-bis 4-methoxyphenyl-2-hydroxyethan-1-one

Specifications

Melting Point	112°C
Color	White-Yellow
Formula Weight	272.30
Physical Form	Crystal-Powder at 20°C
Chemical Name or Material	Anisoin

technical service

Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.

FAQs

What characteristics distinguish the anisoin structure for research applications?

The anisoin structure has a characteristic aromatic ring and hydroxyl groups, resulting in unusual reactivity. This makes anisoin very useful in synthetic organic chemistry and medicinal research, where precise molecular configurations are required.

How does anisoin’s density affect its involvement in chemical synthesis?

Anisoin density, measured in g/cm³, affects solubility and reaction kinetics in chemical processes. Its density enables exact predictions for stoichiometric reactions, resulting in higher yields in high-purity chemical synthesis.

Why is understanding the anisoin structure important in material science?

The anisoin structure’s rigid framework and functional groups make it suitable for creating new materials. Researchers use its molecular structure to develop polymers and novel coatings with improved stability and performance.

While anisoin contains hydroxyl and aromatic groups, anisindione has a diketone structure. This distinction modifies their chemical behaviour, expanding their applicability in medicines and materials research.

How does anisoin density affect its storage and handling?

The exact anisoin density influences its packaging and stability needs. Controlled settings are suggested to preserve its integrity and provide uniformity in laboratory and industrial applications.