| CAS ID | 119-52-8 |
|---|---|
| IUPAC Name | 2-hydroxy-1,2-bis(4-methoxyphenyl)ethan-1-one |
| Molecular Formula | C14H12O2 |
| Molecular Weight | |
| SMILES | COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 |
| CAS ID | 119-52-8 |
|---|---|
| IUPAC Name | 2-hydroxy-1,2-bis(4-methoxyphenyl)ethan-1-one |
| Molecular Formula | C14H12O2 |
| Molecular Weight | |
| SMILES | COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 |
| 95415 |
Synonym: anisoin, 2-hydroxy-1,2-bis 4-methoxyphenyl ethanone, 4,4′-dimethoxybenzoin, p-anisoin, ethanone, 2-hydroxy-1,2-bis 4-methoxyphenyl, benzoin, 4,4′-dimethoxy, p,p’-dimethoxybenzoin, benzoin,4′-dimethoxy, 4,4′-anisoin, 1,2-bis 4-methoxyphenyl-2-hydroxyethan-1-one
| Melting Point | 112°C |
| Color | White-Yellow |
| Formula Weight | 272.30 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Anisoin |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
The anisoin structure has a characteristic aromatic ring and hydroxyl groups, resulting in unusual reactivity. This makes anisoin very useful in synthetic organic chemistry and medicinal research, where precise molecular configurations are required.
Anisoin density, measured in g/cm³, affects solubility and reaction kinetics in chemical processes. Its density enables exact predictions for stoichiometric reactions, resulting in higher yields in high-purity chemical synthesis.
The anisoin structure's rigid framework and functional groups make it suitable for creating new materials. Researchers use its molecular structure to develop polymers and novel coatings with improved stability and performance.
While anisoin contains hydroxyl and aromatic groups, anisindione has a diketone structure. This distinction modifies their chemical behaviour, expanding their applicability in medicines and materials research.
The exact anisoin density influences its packaging and stability needs. Controlled settings are suggested to preserve its integrity and provide uniformity in laboratory and industrial applications.
