| CAS ID | 84-65-1 |
|---|---|
| IUPAC Name | 9,10-dihydroanthracene-9,10-dione |
| Molecular Formula | C14H8O2 |
| Molecular Weight | |
| SMILES | O=C1C2=CC=CC=C2C(=O)C2=CC=CC=C12 |
| CAS ID | 84-65-1 |
|---|---|
| IUPAC Name | 9,10-dihydroanthracene-9,10-dione |
| Molecular Formula | C14H8O2 |
| Molecular Weight | |
| SMILES | O=C1C2=CC=CC=C2C(=O)C2=CC=CC=C12 |
| 6780 |
Synonym : anthraquinone, 9,10-anthraquinone, 9,10-anthracenedione, anthradione, hoelite, 9,10-dioxoanthracene, corbit, morkit, 9,10-anthrachinon, anthra-9,10-quinone
| Boiling Point | 380°C |
| Melting Point | 284°C |
| Color | Undesignated |
| UN Number | 3077 |
| Formula Weight | 208.22 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Anthraquinone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
