| CAS ID | 106246-33-7 |
|---|---|
| IUPAC Name | 6-diethylphenyl)-methane, Bis-(4-amino-3-chloro-2 |
| Molecular Formula | C21H28Cl2N2 |
| Molecular Weight | |
| SMILES | CCC1=C(CC2=C(CC)C=C(N)C(Cl)=C2CC)C(CC)=C(Cl)C(N)=C1 |
| CAS ID | 106246-33-7 |
|---|---|
| IUPAC Name | 6-diethylphenyl)-methane, Bis-(4-amino-3-chloro-2 |
| Molecular Formula | C21H28Cl2N2 |
| Molecular Weight | |
| SMILES | CCC1=C(CC2=C(CC)C=C(N)C(Cl)=C2CC)C(CC)=C(Cl)C(N)=C1 |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
