| CAS ID | 28984-20-5 |
|---|---|
| IUPAC Name | 1,2-diphenylethane-1,2-dithione;nickel |
| Molecular Formula | C28H20NiS4+2 |
| Molecular Weight | |
| SMILES | [Ni].[S-]C(=C(/[S-])C1=CC=CC=C1)C1=CC=CC=C1.[S-]C(=C(/[S-])C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS ID | 28984-20-5 |
|---|---|
| IUPAC Name | 1,2-diphenylethane-1,2-dithione;nickel |
| Molecular Formula | C28H20NiS4+2 |
| Molecular Weight | |
| SMILES | [Ni].[S-]C(=C(/[S-])C1=CC=CC=C1)C1=CC=CC=C1.[S-]C(=C(/[S-])C1=CC=CC=C1)C1=CC=CC=C1 |
| 11272716 |
| Color | Black-Green |
| Formula Weight | 543.40 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Bis(dithiobenzil)nickel(II) |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
