| CAS ID | 80-05-7 |
|---|---|
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| Molecular Formula | C15H16O2 |
| Molecular Weight | |
| SMILES | CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 |
| CAS ID | 80-05-7 |
|---|---|
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| Molecular Formula | C15H16O2 |
| Molecular Weight | |
| SMILES | CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 |
| 6623 |
Synonym: bisphenol a, 2,2-bis 4-hydroxyphenyl propane, 4,4′-isopropylidenediphenol, diphenylolpropane, bisphenol, diano, 4,4′-bisphenol a, 4,4′-propane-2,2-diyl diphenol, biphenol a, dian
| Color | White |
| Melting Point | 156°C |
| Boiling Point | 252°C |
| Formula Weight | 228.29 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,2-Bis(4-hydroxyphenyl)propane |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
