| CAS ID | 16937-99-8 |
|---|---|
| IUPAC Name | (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | |
| SMILES | CC(C)CC(C(=O)O)NC(=O)OC(C)(C)C.O |
| CAS ID | 16937-99-8 |
|---|---|
| IUPAC Name | (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | |
| SMILES | CC(C)CC(C(=O)O)NC(=O)OC(C)(C)C.O |
| 2724763 |
Synonym: boc-d-leucine monohydrate, r-2-tert-butoxycarbonyl amino-4-methylpentanoic acid hydrate, boc-d-leu-oh.h2o, n-boc-d-leucine monohydrate, boc-d-leu-oh h2o, d-leucine, n-1,1-dimethylethoxy carbonyl-, monohydrate, 2r-2-tert-butoxycarbonyl amino-4-methylpentanoic acid hydrate, boc-d-leucine h2o, boc-d-leucine hydrate, n-boc-d-leucinemonohydrate
| Color | White-Yellow |
| Melting Point | 88°C |
| Formula Weight | 231.29 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | N-(tert-Butoxycarbonyl)-D-leucine Hydrate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
