| CAS ID | 127-65-1 |
|---|---|
| IUPAC Name | Chloramine T |
| Molecular Formula | C7H7ClNNaO2S |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[N-]Cl.[Na+] |
| CAS ID | 127-65-1 |
|---|---|
| IUPAC Name | Chloramine T |
| Molecular Formula | C7H7ClNNaO2S |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[N-]Cl.[Na+] |
| 3641960 |
| CAS Min % | 97.0, 0.97 |
| CAS Max % | 100.0, 1.01 |
| Packaging | Amber Poly |
| Physical Form | Liquid |
| Color | Colorless to Yellow |
| Concentration or Composition Notes | 1% (w/v) |
| Chemical Name or Material | Chloramine-T |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
No FAQs available
